C18H35N3O3S — CID 153397624
ethane;S-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]thiohydroxylamine (PubChem CID 153397624) has the molecular formula C18H35N3O3S and a molecular weight of 373.56 g/mol. Its IUPAC name is ethane;S-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]thiohydroxylamine.
| Compound Name | ethane;S-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 153397624 |
| Molecular Formula | C18H35N3O3S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | ethane;S-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]thiohydroxylamine |
| SMILES | CC.CC.CC.NSc1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17N3O3S.3C2H6/c13-19-10-1-2-11(12(7-10)15(16)17)14-8-9-3-5-18-6-4-9;3*1-2/h1-2,7,9,14H,3-6,8,13H2;3*1-2H3 |
| InChIKey | XSROTOCQTATOTQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|