C30H44N6O6 — CID 157296128
N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]-N-methylacetamide;N-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]acetamide (PubChem CID 157296128) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]-N-methylacetamide;N-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]acetamide.
| Compound Name | N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]-N-methylacetamide;N-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 157296128 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]-N-methylacetamide;N-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]acetamide |
| SMILES | CC(=O)N(C)c1ccc(NCC2CCOCC2)c(N)c1.CC(=O)N(C)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N3O4.C15H23N3O2/c1-11(19)17(2)13-3-4-14(15(9-13)18(20)21)16-10-12-5-7-22-8-6-12;1-11(19)18(2)13-3-4-15(14(16)9-13)17-10-12-5-7-20-8-6-12/h3-4,9,12,16H,5-8,10H2,1-2H3;3-4,9,12,17H,5-8,10,16H2,1-2H3 |
| InChIKey | BBJDDAZCFHAHAZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 152.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|