C17H21F6N3O2 — CID 86612462
3-amino-4-(oxan-4-ylmethylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide (PubChem CID 86612462) has the molecular formula C17H21F6N3O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 3-amino-4-(oxan-4-ylmethylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-amino-4-(oxan-4-ylmethylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 86612462 |
| Molecular Formula | C17H21F6N3O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-amino-4-(oxan-4-ylmethylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide |
| SMILES | Nc1cc(C(=O)N(CC(F)(F)F)CC(F)(F)F)ccc1NCC1CCOCC1 |
| InChI | InChI=1S/C17H21F6N3O2/c18-16(19,20)9-26(10-17(21,22)23)15(27)12-1-2-14(13(24)7-12)25-8-11-3-5-28-6-4-11/h1-2,7,11,25H,3-6,8-10,24H2 |
| InChIKey | VIZPEUKOKNJFOO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|