C16H21F6N3O — CID 11668137
3-amino-4-(3-methylbutylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide (PubChem CID 11668137) has the molecular formula C16H21F6N3O and a molecular weight of 385.35 g/mol. Its IUPAC name is 3-amino-4-(3-methylbutylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-amino-4-(3-methylbutylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 11668137 |
| Molecular Formula | C16H21F6N3O |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-amino-4-(3-methylbutylamino)-N,N-bis(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)CCNc1ccc(C(=O)N(CC(F)(F)F)CC(F)(F)F)cc1N |
| InChI | InChI=1S/C16H21F6N3O/c1-10(2)5-6-24-13-4-3-11(7-12(13)23)14(26)25(8-15(17,18)19)9-16(20,21)22/h3-4,7,10,24H,5-6,8-9,23H2,1-2H3 |
| InChIKey | GJKIQEHDDXDBLW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|