C18H25N3O7 — CID 86612986
tert-butyl 4-[2-(3,4-dinitrophenoxy)ethyl]piperidine-1-carboxylate (PubChem CID 86612986) has the molecular formula C18H25N3O7 and a molecular weight of 395.41 g/mol. Its IUPAC name is tert-butyl 4-[2-(3,4-dinitrophenoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3,4-dinitrophenoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86612986 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | tert-butyl 4-[2-(3,4-dinitrophenoxy)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCOc2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H25N3O7/c1-18(2,3)28-17(22)19-9-6-13(7-10-19)8-11-27-14-4-5-15(20(23)24)16(12-14)21(25)26/h4-5,12-13H,6-11H2,1-3H3 |
| InChIKey | KHPUAPZVFXWCSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|