C19H26N2O3 — CID 23034009
tert-butyl 4-[2-(4-cyanophenoxy)ethyl]piperidine-1-carboxylate (PubChem CID 23034009) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-cyanophenoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-cyanophenoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23034009 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 4-[2-(4-cyanophenoxy)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCOc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,3)24-18(22)21-11-8-15(9-12-21)10-13-23-17-6-4-16(14-20)5-7-17/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | WTKOWIFRAOEVJK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |