C25H39NO5 — CID 159636919
tert-butyl 4-[3-[4-(4-hydroxy-3,3-dimethylbutanoyl)phenoxy]propyl]piperidine-1-carboxylate (PubChem CID 159636919) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(4-hydroxy-3,3-dimethylbutanoyl)phenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(4-hydroxy-3,3-dimethylbutanoyl)phenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159636919 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | tert-butyl 4-[3-[4-(4-hydroxy-3,3-dimethylbutanoyl)phenoxy]propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(CO)CC(=O)c1ccc(OCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H39NO5/c1-24(2,3)31-23(29)26-14-12-19(13-15-26)7-6-16-30-21-10-8-20(9-11-21)22(28)17-25(4,5)18-27/h8-11,19,27H,6-7,12-18H2,1-5H3 |
| InChIKey | MPWATSIENJUNNX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|