C23H37NO4 — CID 123723111
tert-butyl 4-[3-[4-(1-methoxyethyl)-3-methylphenoxy]propyl]piperidine-1-carboxylate (PubChem CID 123723111) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(1-methoxyethyl)-3-methylphenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(1-methoxyethyl)-3-methylphenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123723111 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | tert-butyl 4-[3-[4-(1-methoxyethyl)-3-methylphenoxy]propyl]piperidine-1-carboxylate |
| SMILES | COC(C)c1ccc(OCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C23H37NO4/c1-17-16-20(9-10-21(17)18(2)26-6)27-15-7-8-19-11-13-24(14-12-19)22(25)28-23(3,4)5/h9-10,16,18-19H,7-8,11-15H2,1-6H3 |
| InChIKey | OJZXPBAWFZSCCD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|