C24H37FN2O4 — CID 153112175
tert-butyl 4-[3-[4-(5-aminopentanoyl)-3-fluorophenoxy]propyl]piperidine-1-carboxylate (PubChem CID 153112175) has the molecular formula C24H37FN2O4 and a molecular weight of 436.57 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(5-aminopentanoyl)-3-fluorophenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(5-aminopentanoyl)-3-fluorophenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 153112175 |
| Molecular Formula | C24H37FN2O4 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | tert-butyl 4-[3-[4-(5-aminopentanoyl)-3-fluorophenoxy]propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCOc2ccc(C(=O)CCCCN)c(F)c2)CC1 |
| InChI | InChI=1S/C24H37FN2O4/c1-24(2,3)31-23(29)27-14-11-18(12-15-27)7-6-16-30-19-9-10-20(21(25)17-19)22(28)8-4-5-13-26/h9-10,17-18H,4-8,11-16,26H2,1-3H3 |
| InChIKey | VTDMEOJWQZPEPJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|