C21H31FN3O4+ — CID 143923615
1-[[2-fluoro-4-[3-(1-propan-2-yloxycarbonylpiperidin-4-yl)propoxy]benzoyl]amino]ethylideneazanium (PubChem CID 143923615) has the molecular formula C21H31FN3O4+ and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-[[2-fluoro-4-[3-(1-propan-2-yloxycarbonylpiperidin-4-yl)propoxy]benzoyl]amino]ethylideneazanium.
| Compound Name | 1-[[2-fluoro-4-[3-(1-propan-2-yloxycarbonylpiperidin-4-yl)propoxy]benzoyl]amino]ethylideneazanium |
|---|---|
| PubChem CID | 143923615 |
| Molecular Formula | C21H31FN3O4+ |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[[2-fluoro-4-[3-(1-propan-2-yloxycarbonylpiperidin-4-yl)propoxy]benzoyl]amino]ethylideneazanium |
| SMILES | CC(=[NH2+])NC(=O)c1ccc(OCCCC2CCN(C(=O)OC(C)C)CC2)cc1F |
| InChI | InChI=1S/C21H30FN3O4/c1-14(2)29-21(27)25-10-8-16(9-11-25)5-4-12-28-17-6-7-18(19(22)13-17)20(26)24-15(3)23/h6-7,13-14,16H,4-5,8-12H2,1-3H3,(H2,23,24,26)/p+1 |
| InChIKey | GOKRMDYCOOZZBT-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|