C22H32F2N2O4 — CID 59234081
tert-butyl 4-[3-[4-(ethylcarbamoyl)-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate (PubChem CID 59234081) has the molecular formula C22H32F2N2O4 and a molecular weight of 426.50 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(ethylcarbamoyl)-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(ethylcarbamoyl)-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59234081 |
| Molecular Formula | C22H32F2N2O4 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl 4-[3-[4-(ethylcarbamoyl)-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate |
| SMILES | CCNC(=O)c1c(F)cc(OCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C22H32F2N2O4/c1-5-25-20(27)19-17(23)13-16(14-18(19)24)29-12-6-7-15-8-10-26(11-9-15)21(28)30-22(2,3)4/h13-15H,5-12H2,1-4H3,(H,25,27) |
| InChIKey | DYHUZLCXVRRVJJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|