C22H32F2N2O5 — CID 87261464
tert-butyl 4-[3-[4-[ethyl(hydroxy)carbamoyl]-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate (PubChem CID 87261464) has the molecular formula C22H32F2N2O5 and a molecular weight of 442.50 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[ethyl(hydroxy)carbamoyl]-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[ethyl(hydroxy)carbamoyl]-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87261464 |
| Molecular Formula | C22H32F2N2O5 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | tert-butyl 4-[3-[4-[ethyl(hydroxy)carbamoyl]-3,5-difluorophenoxy]propyl]piperidine-1-carboxylate |
| SMILES | CCN(O)C(=O)c1c(F)cc(OCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C22H32F2N2O5/c1-5-26(29)20(27)19-17(23)13-16(14-18(19)24)30-12-6-7-15-8-10-25(11-9-15)21(28)31-22(2,3)4/h13-15,29H,5-12H2,1-4H3 |
| InChIKey | GISDSPXMXWTZDD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|