C20H30FNO4S — CID 59234126
tert-butyl 4-[3-(3-fluoro-4-methylsulfinylphenoxy)propyl]piperidine-1-carboxylate (PubChem CID 59234126) has the molecular formula C20H30FNO4S and a molecular weight of 399.53 g/mol. Its IUPAC name is tert-butyl 4-[3-(3-fluoro-4-methylsulfinylphenoxy)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(3-fluoro-4-methylsulfinylphenoxy)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59234126 |
| Molecular Formula | C20H30FNO4S |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl 4-[3-(3-fluoro-4-methylsulfinylphenoxy)propyl]piperidine-1-carboxylate |
| SMILES | CS(=O)c1ccc(OCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C20H30FNO4S/c1-20(2,3)26-19(23)22-11-9-15(10-12-22)6-5-13-25-16-7-8-18(27(4)24)17(21)14-16/h7-8,14-15H,5-6,9-13H2,1-4H3 |
| InChIKey | PXSOUNINUARKIY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|