C22H32F3NO3S — CID 59234060
tert-butyl 4-[4-[4-methylsulfinyl-3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboxylate (PubChem CID 59234060) has the molecular formula C22H32F3NO3S and a molecular weight of 447.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-methylsulfinyl-3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-methylsulfinyl-3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59234060 |
| Molecular Formula | C22H32F3NO3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | tert-butyl 4-[4-[4-methylsulfinyl-3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboxylate |
| SMILES | CS(=O)c1ccc(CCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H32F3NO3S/c1-21(2,3)29-20(27)26-13-11-16(12-14-26)7-5-6-8-17-9-10-19(30(4)28)18(15-17)22(23,24)25/h9-10,15-16H,5-8,11-14H2,1-4H3 |
| InChIKey | QUTNKPSLCUVFPS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|