C21H32BrNO2 — CID 170321990
tert-butyl 4-[4-(3-bromo-2-methylphenyl)butyl]piperidine-1-carboxylate (PubChem CID 170321990) has the molecular formula C21H32BrNO2 and a molecular weight of 410.40 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-bromo-2-methylphenyl)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-bromo-2-methylphenyl)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170321990 |
| Molecular Formula | C21H32BrNO2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | tert-butyl 4-[4-(3-bromo-2-methylphenyl)butyl]piperidine-1-carboxylate |
| SMILES | Cc1c(Br)cccc1CCCCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32BrNO2/c1-16-18(10-7-11-19(16)22)9-6-5-8-17-12-14-23(15-13-17)20(24)25-21(2,3)4/h7,10-11,17H,5-6,8-9,12-15H2,1-4H3 |
| InChIKey | VYOMWNRBPFCFSJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|