C21H30BrNO3 — CID 170321951
tert-butyl 6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 170321951) has the molecular formula C21H30BrNO3 and a molecular weight of 424.38 g/mol. Its IUPAC name is tert-butyl 6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170321951 |
| Molecular Formula | C21H30BrNO3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | tert-butyl 6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | Cc1c(Br)cccc1OCCCC1CC2(C1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C21H30BrNO3/c1-15-17(22)8-5-9-18(15)25-10-6-7-16-11-21(12-16)13-23(14-21)19(24)26-20(2,3)4/h5,8-9,16H,6-7,10-14H2,1-4H3 |
| InChIKey | YMVVCAKKCPHDNI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|