C19H28BrNO3 — CID 176887173
(3R)-3-[3-(3-bromo-2-methylphenoxy)propyl]-2-tert-butylpyrrolidine-1-carboxylic acid (PubChem CID 176887173) has the molecular formula C19H28BrNO3 and a molecular weight of 398.34 g/mol. Its IUPAC name is (3R)-3-[3-(3-bromo-2-methylphenoxy)propyl]-2-tert-butylpyrrolidine-1-carboxylic acid.
| Compound Name | (3R)-3-[3-(3-bromo-2-methylphenoxy)propyl]-2-tert-butylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 176887173 |
| Molecular Formula | C19H28BrNO3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (3R)-3-[3-(3-bromo-2-methylphenoxy)propyl]-2-tert-butylpyrrolidine-1-carboxylic acid |
| SMILES | Cc1c(Br)cccc1OCCC[C@@H]1CCN(C(=O)O)C1C(C)(C)C |
| InChI | InChI=1S/C19H28BrNO3/c1-13-15(20)8-5-9-16(13)24-12-6-7-14-10-11-21(18(22)23)17(14)19(2,3)4/h5,8-9,14,17H,6-7,10-12H2,1-4H3,(H,22,23)/t14-,17?/m1/s1 |
| InChIKey | NTKMYHCTADGTTC-XPCCGILXSA-N |
| XLogP | 5.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|