C20H28BrNO3 — CID 170321921
2-[(3R)-3-[2-(3-bromo-2-methylphenoxy)ethyl]-8-azaspiro[4.5]decan-8-yl]acetic acid (PubChem CID 170321921) has the molecular formula C20H28BrNO3 and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-[(3R)-3-[2-(3-bromo-2-methylphenoxy)ethyl]-8-azaspiro[4.5]decan-8-yl]acetic acid.
| Compound Name | 2-[(3R)-3-[2-(3-bromo-2-methylphenoxy)ethyl]-8-azaspiro[4.5]decan-8-yl]acetic acid |
|---|---|
| PubChem CID | 170321921 |
| Molecular Formula | C20H28BrNO3 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[(3R)-3-[2-(3-bromo-2-methylphenoxy)ethyl]-8-azaspiro[4.5]decan-8-yl]acetic acid |
| SMILES | Cc1c(Br)cccc1OCC[C@@H]1CCC2(CCN(CC(=O)O)CC2)C1 |
| InChI | InChI=1S/C20H28BrNO3/c1-15-17(21)3-2-4-18(15)25-12-6-16-5-7-20(13-16)8-10-22(11-9-20)14-19(23)24/h2-4,16H,5-14H2,1H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | QTFUNBXGJAUYHZ-INIZCTEOSA-N |
| XLogP | 4.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |