C20H28BrNO3 — CID 170321866
ethyl 2-[6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptan-2-yl]acetate (PubChem CID 170321866) has the molecular formula C20H28BrNO3 and a molecular weight of 410.35 g/mol. Its IUPAC name is ethyl 2-[6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptan-2-yl]acetate.
| Compound Name | ethyl 2-[6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptan-2-yl]acetate |
|---|---|
| PubChem CID | 170321866 |
| Molecular Formula | C20H28BrNO3 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl 2-[6-[3-(3-bromo-2-methylphenoxy)propyl]-2-azaspiro[3.3]heptan-2-yl]acetate |
| SMILES | CCOC(=O)CN1CC2(CC(CCCOc3cccc(Br)c3C)C2)C1 |
| InChI | InChI=1S/C20H28BrNO3/c1-3-24-19(23)12-22-13-20(14-22)10-16(11-20)6-5-9-25-18-8-4-7-17(21)15(18)2/h4,7-8,16H,3,5-6,9-14H2,1-2H3 |
| InChIKey | GHXSJSOLPXDCLZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|