C19H29BrN2O2 — CID 170322386
ethyl 2-[4-[4-(3-bromo-2-methylphenyl)butyl]piperazin-1-yl]acetate (PubChem CID 170322386) has the molecular formula C19H29BrN2O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is ethyl 2-[4-[4-(3-bromo-2-methylphenyl)butyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-(3-bromo-2-methylphenyl)butyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 170322386 |
| Molecular Formula | C19H29BrN2O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | ethyl 2-[4-[4-(3-bromo-2-methylphenyl)butyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CCCCc2cccc(Br)c2C)CC1 |
| InChI | InChI=1S/C19H29BrN2O2/c1-3-24-19(23)15-22-13-11-21(12-14-22)10-5-4-7-17-8-6-9-18(20)16(17)2/h6,8-9H,3-5,7,10-15H2,1-2H3 |
| InChIKey | GDRDXFAXTUNNOJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|