C24H44IN4NaO8 — CID 23722784
sodium;ethyl 2-[4,7,10-tris(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;iodide (PubChem CID 23722784) has the molecular formula C24H44IN4NaO8 and a molecular weight of 666.53 g/mol. Its IUPAC name is sodium;ethyl 2-[4,7,10-tris(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;iodide.
| Compound Name | sodium;ethyl 2-[4,7,10-tris(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;iodide |
|---|---|
| PubChem CID | 23722784 |
| Molecular Formula | C24H44IN4NaO8 |
| Molecular Weight | 666.53 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | sodium;ethyl 2-[4,7,10-tris(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;iodide |
| SMILES | CCOC(=O)CN1CCN(CC(=O)OCC)CCN(CC(=O)OCC)CCN(CC(=O)OCC)CC1.[I-].[Na+] |
| InChI | InChI=1S/C24H44N4O8.HI.Na/c1-5-33-21(29)17-25-9-11-26(18-22(30)34-6-2)13-15-28(20-24(32)36-8-4)16-14-27(12-10-25)19-23(31)35-7-3;;/h5-20H2,1-4H3;1H;/q;;+1/p-1 |
| InChIKey | AXPDCEXDRFKZSJ-UHFFFAOYSA-M |
| XLogP | -6.53 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.53 |
| LogP ≤ 5 | -6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|