C22H42N4O6 — CID 59227643
ethyl 2-[4,8-bis(2-ethoxy-2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate (PubChem CID 59227643) has the molecular formula C22H42N4O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl 2-[4,8-bis(2-ethoxy-2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate.
| Compound Name | ethyl 2-[4,8-bis(2-ethoxy-2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate |
|---|---|
| PubChem CID | 59227643 |
| Molecular Formula | C22H42N4O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | ethyl 2-[4,8-bis(2-ethoxy-2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCN(CC(=O)OCC)CCN(CC(=O)OCC)CCCNCC1 |
| InChI | InChI=1S/C22H42N4O6/c1-4-30-20(27)17-24-12-8-13-26(19-22(29)32-6-3)16-15-25(18-21(28)31-5-2)11-7-9-23-10-14-24/h23H,4-19H2,1-3H3 |
| InChIKey | APGZKXGVFQQQGC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|