C10H19N3O2 — CID 69133633
pyrrolidin-1-yl 2-piperazin-1-ylacetate (PubChem CID 69133633) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is pyrrolidin-1-yl 2-piperazin-1-ylacetate.
| Compound Name | pyrrolidin-1-yl 2-piperazin-1-ylacetate |
|---|---|
| PubChem CID | 69133633 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | pyrrolidin-1-yl 2-piperazin-1-ylacetate |
| SMILES | O=C(CN1CCNCC1)ON1CCCC1 |
| InChI | InChI=1S/C10H19N3O2/c14-10(15-13-5-1-2-6-13)9-12-7-3-11-4-8-12/h11H,1-9H2 |
| InChIKey | KBWCUHDWTWINNF-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |