C10H20N2O3 — CID 62823958
2-methoxyethyl 2-(1,4-diazepan-1-yl)acetate (PubChem CID 62823958) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-methoxyethyl 2-(1,4-diazepan-1-yl)acetate.
| Compound Name | 2-methoxyethyl 2-(1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 62823958 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-methoxyethyl 2-(1,4-diazepan-1-yl)acetate |
| SMILES | COCCOC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C10H20N2O3/c1-14-7-8-15-10(13)9-12-5-2-3-11-4-6-12/h11H,2-9H2,1H3 |
| InChIKey | DAIGLVWZFACAKX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|