About 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate (PubChem CID 104562881) has the molecular formula C13H26N2O5
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate |
| PubChem CID | 104562881 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate |
| SMILES | COCCOCCOCCOC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C13H26N2O5/c1-17-6-7-18-8-9-19-10-11-20-13(16)12-15-4-2-14-3-5-15/h14H,2-12H2,1H3 |
| InChIKey | REPVDHHHWJQQGV-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate (CID 104562881) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate is COCCOCCOCCOC(=O)CN1CCNCC1.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate?
The InChIKey is REPVDHHHWJQQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O5/c1-17-6-7-18-8-9-19-10-11-20-13(16)12-15-4-2-14-3-5-15/h14H,2-12H2,1H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate?
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate has a molecular weight of 290.36 g/mol, XLogP of -0.89, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-piperazin-1-ylacetate is sourced from PubChem (CID 104562881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).