C12H21F3N2O5 — CID 70086364
2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid (PubChem CID 70086364) has the molecular formula C12H21F3N2O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70086364 |
| Molecular Formula | C12H21F3N2O5 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)OCCOCCN1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H20N2O3.C2HF3O2/c1-10(13)15-9-8-14-7-6-12-4-2-11-3-5-12;3-2(4,5)1(6)7/h11H,2-9H2,1H3;(H,6,7) |
| InChIKey | BFRVEOQHOXIHJN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|