2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid

C12H21F3N2O5 — CID 70086364

IUPAC2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid
SMILESCC(=O)OCCOCCN1CCNCC1.O=C(O)C(F)(F)F
InChIInChI=1S/C10H20N2O3.C2HF3O2/c1-10(13)15-9-8-14-7-6-12-4-2-11-3-5-12;3-2(4,5)1(6)7/h11H,2-9H2,1H3;(H,6,7)
InChIKeyBFRVEOQHOXIHJN-UHFFFAOYSA-N
MW330.30 g/mol
LogP0.10
Rot. Bonds6

About 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid

2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid (PubChem CID 70086364) has the molecular formula C12H21F3N2O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid
PubChem CID70086364
Molecular FormulaC12H21F3N2O5
Molecular Weight330.30 g/mol
Exact Mass330.14
IUPAC Name2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid
SMILESCC(=O)OCCOCCN1CCNCC1.O=C(O)C(F)(F)F
InChIInChI=1S/C10H20N2O3.C2HF3O2/c1-10(13)15-9-8-14-7-6-12-4-2-11-3-5-12;3-2(4,5)1(6)7/h11H,2-9H2,1H3;(H,6,7)
InChIKeyBFRVEOQHOXIHJN-UHFFFAOYSA-N
XLogP0.10
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.30
LogP ≤ 50.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid?
The IUPAC name of 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid (CID 70086364) is 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid is CC(=O)OCCOCCN1CCNCC1.O=C(O)C(F)(F)F.
What is the InChIKey of 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid?
The InChIKey is BFRVEOQHOXIHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3.C2HF3O2/c1-10(13)15-9-8-14-7-6-12-4-2-11-3-5-12;3-2(4,5)1(6)7/h11H,2-9H2,1H3;(H,6,7).
What are the key properties of 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid?
2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid has a molecular weight of 330.30 g/mol, XLogP of 0.10, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-piperazin-1-ylethoxy)ethyl acetate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 70086364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).