C16H32N2O5 — CID 90281059
tert-butyl 2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]acetate (PubChem CID 90281059) has the molecular formula C16H32N2O5 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 90281059 |
| Molecular Formula | C16H32N2O5 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | tert-butyl 2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCN1CCNCC1 |
| InChI | InChI=1S/C16H32N2O5/c1-16(2,3)23-15(19)14-22-13-12-21-11-10-20-9-8-18-6-4-17-5-7-18/h17H,4-14H2,1-3H3 |
| InChIKey | NMKNBAIOBHXGGP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|