C12H23BrO5 — CID 126480423
tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate (PubChem CID 126480423) has the molecular formula C12H23BrO5 and a molecular weight of 327.22 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 126480423 |
| Molecular Formula | C12H23BrO5 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCBr |
| InChI | InChI=1S/C12H23BrO5/c1-12(2,3)18-11(14)10-17-9-8-16-7-6-15-5-4-13/h4-10H2,1-3H3 |
| InChIKey | WDLOTPAWUBQPND-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|