C19H38O9 — CID 155606966
tert-butyl 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 155606966) has the molecular formula C19H38O9 and a molecular weight of 410.50 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 155606966 |
| Molecular Formula | C19H38O9 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | COCCOCCOCCOCCOCCOCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38O9/c1-19(2,3)28-18(20)17-27-16-15-26-14-13-25-12-11-24-10-9-23-8-7-22-6-5-21-4/h5-17H2,1-4H3 |
| InChIKey | SEKVRTUKRDKAFU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|