C16H21F3N2O4 — CID 175704265
3-piperazin-1-ylpropyl benzoate;2,2,2-trifluoroacetic acid (PubChem CID 175704265) has the molecular formula C16H21F3N2O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is 3-piperazin-1-ylpropyl benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | 3-piperazin-1-ylpropyl benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175704265 |
| Molecular Formula | C16H21F3N2O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-piperazin-1-ylpropyl benzoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCCCN1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O2.C2HF3O2/c17-14(13-5-2-1-3-6-13)18-12-4-9-16-10-7-15-8-11-16;3-2(4,5)1(6)7/h1-3,5-6,15H,4,7-12H2;(H,6,7) |
| InChIKey | HKCXYTYLVSAQDH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|