C14H20O2 — CID 138733970
4,4-dimethylpentyl benzoate (PubChem CID 138733970) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 4,4-dimethylpentyl benzoate.
| Compound Name | 4,4-dimethylpentyl benzoate |
|---|---|
| PubChem CID | 138733970 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 4,4-dimethylpentyl benzoate |
| SMILES | CC(C)(C)CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-14(2,3)10-7-11-16-13(15)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | KCQXLJXXRTVGGY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|