C34H39ClO6 — CID 89227631
[4,4-bis(3-benzoyloxypropyl)-7-chloroheptyl] benzoate (PubChem CID 89227631) has the molecular formula C34H39ClO6 and a molecular weight of 579.13 g/mol. Its IUPAC name is [4,4-bis(3-benzoyloxypropyl)-7-chloroheptyl] benzoate.
| Compound Name | [4,4-bis(3-benzoyloxypropyl)-7-chloroheptyl] benzoate |
|---|---|
| PubChem CID | 89227631 |
| Molecular Formula | C34H39ClO6 |
| Molecular Weight | 579.13 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | [4,4-bis(3-benzoyloxypropyl)-7-chloroheptyl] benzoate |
| SMILES | O=C(OCCCC(CCCCl)(CCCOC(=O)c1ccccc1)CCCOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H39ClO6/c35-24-10-20-34(21-11-25-39-31(36)28-14-4-1-5-15-28,22-12-26-40-32(37)29-16-6-2-7-17-29)23-13-27-41-33(38)30-18-8-3-9-19-30/h1-9,14-19H,10-13,20-27H2 |
| InChIKey | CVKMIKOCLIONSO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.13 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|