C11H12Cl2O2 — CID 154188373
4,4-dichlorobutyl benzoate (PubChem CID 154188373) has the molecular formula C11H12Cl2O2 and a molecular weight of 247.12 g/mol. Its IUPAC name is 4,4-dichlorobutyl benzoate.
| Compound Name | 4,4-dichlorobutyl benzoate |
|---|---|
| PubChem CID | 154188373 |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 4,4-dichlorobutyl benzoate |
| SMILES | O=C(OCCCC(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H12Cl2O2/c12-10(13)7-4-8-15-11(14)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | GNJACSJZOIWHHF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|