C20H28Cl2O4 — CID 91724526
bis(6-chlorohexyl) benzene-1,3-dicarboxylate (PubChem CID 91724526) has the molecular formula C20H28Cl2O4 and a molecular weight of 403.35 g/mol. Its IUPAC name is bis(6-chlorohexyl) benzene-1,3-dicarboxylate.
| Compound Name | bis(6-chlorohexyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91724526 |
| Molecular Formula | C20H28Cl2O4 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | bis(6-chlorohexyl) benzene-1,3-dicarboxylate |
| SMILES | O=C(OCCCCCCCl)c1cccc(C(=O)OCCCCCCCl)c1 |
| InChI | InChI=1S/C20H28Cl2O4/c21-12-5-1-3-7-14-25-19(23)17-10-9-11-18(16-17)20(24)26-15-8-4-2-6-13-22/h9-11,16H,1-8,12-15H2 |
| InChIKey | YGMDXZHNVRXBEG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|