About 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate
5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate (PubChem CID 59593953) has the molecular formula C13H17ClN2O3
and a molecular weight of 284.74 g/mol. Its IUPAC name is 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate.
Molecular Properties
| Compound Name | 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate |
| PubChem CID | 59593953 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate |
| SMILES | N/C(=N/O)c1cccc(C(=O)OCCCCCCl)c1 |
| InChI | InChI=1S/C13H17ClN2O3/c14-7-2-1-3-8-19-13(17)11-6-4-5-10(9-11)12(15)16-18/h4-6,9,18H,1-3,7-8H2,(H2,15,16) |
| InChIKey | BPOLPCCSLLVHTR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate?
The IUPAC name of 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate (CID 59593953) is 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate.
What is the SMILES notation for 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate?
The canonical SMILES for 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate is N/C(=N/O)c1cccc(C(=O)OCCCCCCl)c1.
What is the InChIKey of 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate?
The InChIKey is BPOLPCCSLLVHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O3/c14-7-2-1-3-8-19-13(17)11-6-4-5-10(9-11)12(15)16-18/h4-6,9,18H,1-3,7-8H2,(H2,15,16).
What are the key properties of 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate?
5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate has a molecular weight of 284.74 g/mol, XLogP of 2.35, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloropentyl 3-[(E)-N'-hydroxycarbamimidoyl]benzoate is sourced from PubChem (CID 59593953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).