About butyl 3-(N'-hydroxycarbamimidoyl)benzoate
butyl 3-(N'-hydroxycarbamimidoyl)benzoate (PubChem CID 123693701) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is butyl 3-(N'-hydroxycarbamimidoyl)benzoate.
Molecular Properties
| Compound Name | butyl 3-(N'-hydroxycarbamimidoyl)benzoate |
| PubChem CID | 123693701 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | butyl 3-(N'-hydroxycarbamimidoyl)benzoate |
| SMILES | CCCCOC(=O)c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C12H16N2O3/c1-2-3-7-17-12(15)10-6-4-5-9(8-10)11(13)14-16/h4-6,8,16H,2-3,7H2,1H3,(H2,13,14) |
| InChIKey | NYIVTCNIAUGUPH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-(N'-hydroxycarbamimidoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-(N'-hydroxycarbamimidoyl)benzoate?
The IUPAC name of butyl 3-(N'-hydroxycarbamimidoyl)benzoate (CID 123693701) is butyl 3-(N'-hydroxycarbamimidoyl)benzoate.
What is the SMILES notation for butyl 3-(N'-hydroxycarbamimidoyl)benzoate?
The canonical SMILES for butyl 3-(N'-hydroxycarbamimidoyl)benzoate is CCCCOC(=O)c1cccc(C(N)=NO)c1.
What is the InChIKey of butyl 3-(N'-hydroxycarbamimidoyl)benzoate?
The InChIKey is NYIVTCNIAUGUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-2-3-7-17-12(15)10-6-4-5-9(8-10)11(13)14-16/h4-6,8,16H,2-3,7H2,1H3,(H2,13,14).
What are the key properties of butyl 3-(N'-hydroxycarbamimidoyl)benzoate?
butyl 3-(N'-hydroxycarbamimidoyl)benzoate has a molecular weight of 236.27 g/mol, XLogP of 1.74, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-(N'-hydroxycarbamimidoyl)benzoate is sourced from PubChem (CID 123693701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).