C14H22N2O3 — CID 43128365
3-(2-butoxyethoxymethyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 43128365) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(2-butoxyethoxymethyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-(2-butoxyethoxymethyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 43128365 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-(2-butoxyethoxymethyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCOCCOCc1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-2-3-7-18-8-9-19-11-12-5-4-6-13(10-12)14(15)16-17/h4-6,10,17H,2-3,7-9,11H2,1H3,(H2,15,16) |
| InChIKey | VLZCYKSKNHLUAJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|