C20H26N2O3 — CID 119754343
3-amino-N-[3-(2-butoxyethoxymethyl)phenyl]benzamide (PubChem CID 119754343) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-amino-N-[3-(2-butoxyethoxymethyl)phenyl]benzamide.
| Compound Name | 3-amino-N-[3-(2-butoxyethoxymethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 119754343 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-amino-N-[3-(2-butoxyethoxymethyl)phenyl]benzamide |
| SMILES | CCCCOCCOCc1cccc(NC(=O)c2cccc(N)c2)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-2-3-10-24-11-12-25-15-16-6-4-9-19(13-16)22-20(23)17-7-5-8-18(21)14-17/h4-9,13-14H,2-3,10-12,15,21H2,1H3,(H,22,23) |
| InChIKey | KQDZTSMDCSRLQQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|