C15H24N2O4 — CID 76905016
4-(2-butoxyethoxy)-3-ethoxy-N'-hydroxybenzenecarboximidamide (PubChem CID 76905016) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(2-butoxyethoxy)-3-ethoxy-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(2-butoxyethoxy)-3-ethoxy-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 76905016 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-(2-butoxyethoxy)-3-ethoxy-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCOCCOc1ccc(C(N)=NO)cc1OCC |
| InChI | InChI=1S/C15H24N2O4/c1-3-5-8-19-9-10-21-13-7-6-12(15(16)17-18)11-14(13)20-4-2/h6-7,11,18H,3-5,8-10H2,1-2H3,(H2,16,17) |
| InChIKey | YVYVQRZUQFZSRG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|