C9H11BrN2O2 — CID 82799087
3-bromo-4-ethoxy-N'-hydroxybenzenecarboximidamide (PubChem CID 82799087) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-bromo-4-ethoxy-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 82799087 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3-bromo-4-ethoxy-N'-hydroxybenzenecarboximidamide |
| SMILES | CCOc1ccc(/C(N)=N/O)cc1Br |
| InChI | InChI=1S/C9H11BrN2O2/c1-2-14-8-4-3-6(5-7(8)10)9(11)12-13/h3-5,13H,2H2,1H3,(H2,11,12) |
| InChIKey | JHHCGIAYGOJVNU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|