C11H16N2O4 — CID 24691682
N'-hydroxy-3-methoxy-4-(2-methoxyethoxy)benzenecarboximidamide (PubChem CID 24691682) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N'-hydroxy-3-methoxy-4-(2-methoxyethoxy)benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-methoxy-4-(2-methoxyethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 24691682 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N'-hydroxy-3-methoxy-4-(2-methoxyethoxy)benzenecarboximidamide |
| SMILES | COCCOc1ccc(/C(N)=N/O)cc1OC |
| InChI | InChI=1S/C11H16N2O4/c1-15-5-6-17-9-4-3-8(11(12)13-14)7-10(9)16-2/h3-4,7,14H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | VWYNLGJIQQGWEV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|