C13H14N2O3S — CID 43646207
N'-hydroxy-3-methoxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide (PubChem CID 43646207) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N'-hydroxy-3-methoxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-methoxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 43646207 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N'-hydroxy-3-methoxy-4-(thiophen-3-ylmethoxy)benzenecarboximidamide |
| SMILES | COc1cc(/C(N)=N/O)ccc1OCc1ccsc1 |
| InChI | InChI=1S/C13H14N2O3S/c1-17-12-6-10(13(14)15-16)2-3-11(12)18-7-9-4-5-19-8-9/h2-6,8,16H,7H2,1H3,(H2,14,15) |
| InChIKey | VPDAOYSDEVRHAE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|