C19H25F3O5 — CID 86099446
5-[5-(2,2,2-trifluoroacetyl)oxypentoxy]pentyl benzoate (PubChem CID 86099446) has the molecular formula C19H25F3O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 5-[5-(2,2,2-trifluoroacetyl)oxypentoxy]pentyl benzoate.
| Compound Name | 5-[5-(2,2,2-trifluoroacetyl)oxypentoxy]pentyl benzoate |
|---|---|
| PubChem CID | 86099446 |
| Molecular Formula | C19H25F3O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-[5-(2,2,2-trifluoroacetyl)oxypentoxy]pentyl benzoate |
| SMILES | O=C(OCCCCCOCCCCCOC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H25F3O5/c20-19(21,22)18(24)27-15-9-3-7-13-25-12-6-2-8-14-26-17(23)16-10-4-1-5-11-16/h1,4-5,10-11H,2-3,6-9,12-15H2 |
| InChIKey | WCKQKKDHQNSMHR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|