C12H16F6O5 — CID 91692720
4-[4-(2,2,2-trifluoroacetyl)oxybutoxy]butyl 2,2,2-trifluoroacetate (PubChem CID 91692720) has the molecular formula C12H16F6O5 and a molecular weight of 354.24 g/mol. Its IUPAC name is 4-[4-(2,2,2-trifluoroacetyl)oxybutoxy]butyl 2,2,2-trifluoroacetate.
| Compound Name | 4-[4-(2,2,2-trifluoroacetyl)oxybutoxy]butyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91692720 |
| Molecular Formula | C12H16F6O5 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[4-(2,2,2-trifluoroacetyl)oxybutoxy]butyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCCCOCCCCOC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6O5/c13-11(14,15)9(19)22-7-3-1-5-21-6-2-4-8-23-10(20)12(16,17)18/h1-8H2 |
| InChIKey | ACGJWBAAODRQEP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|