C24H45F3O8 — CID 6428153
2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate (PubChem CID 6428153) has the molecular formula C24H45F3O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 6428153 |
| Molecular Formula | C24H45F3O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCCCCOCCOCCOCCOCCOCCOCCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H45F3O8/c1-2-3-4-5-6-7-8-9-10-29-11-12-30-13-14-31-15-16-32-17-18-33-19-20-34-21-22-35-23(28)24(25,26)27/h2-22H2,1H3 |
| InChIKey | WVCOKZMBNLWPHL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|