C26H49F3O9 — CID 6428147
2-[2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate (PubChem CID 6428147) has the molecular formula C26H49F3O9 and a molecular weight of 562.66 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 6428147 |
| Molecular Formula | C26H49F3O9 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCCCCOCCOCCOCCOCCOCCOCCOCCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H49F3O9/c1-2-3-4-5-6-7-8-9-10-31-11-12-32-13-14-33-15-16-34-17-18-35-19-20-36-21-22-37-23-24-38-25(30)26(27,28)29/h2-24H2,1H3 |
| InChIKey | JXZNCKAJDHXPHL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|