About 2-(2-decoxyethoxy)ethyl acetate
2-(2-decoxyethoxy)ethyl acetate (PubChem CID 526732) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-(2-decoxyethoxy)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2-decoxyethoxy)ethyl acetate |
| PubChem CID | 526732 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-(2-decoxyethoxy)ethyl acetate |
| SMILES | CCCCCCCCCCOCCOCCOC(C)=O |
| InChI | InChI=1S/C16H32O4/c1-3-4-5-6-7-8-9-10-11-18-12-13-19-14-15-20-16(2)17/h3-15H2,1-2H3 |
| InChIKey | ASRPERSRLFXPEG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-decoxyethoxy)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-decoxyethoxy)ethyl acetate?
The IUPAC name of 2-(2-decoxyethoxy)ethyl acetate (CID 526732) is 2-(2-decoxyethoxy)ethyl acetate.
What is the SMILES notation for 2-(2-decoxyethoxy)ethyl acetate?
The canonical SMILES for 2-(2-decoxyethoxy)ethyl acetate is CCCCCCCCCCOCCOCCOC(C)=O.
What is the InChIKey of 2-(2-decoxyethoxy)ethyl acetate?
The InChIKey is ASRPERSRLFXPEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O4/c1-3-4-5-6-7-8-9-10-11-18-12-13-19-14-15-20-16(2)17/h3-15H2,1-2H3.
What are the key properties of 2-(2-decoxyethoxy)ethyl acetate?
2-(2-decoxyethoxy)ethyl acetate has a molecular weight of 288.43 g/mol, XLogP of 3.72, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-decoxyethoxy)ethyl acetate is sourced from PubChem (CID 526732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).