About alumane;hexyl acetate
alumane;hexyl acetate (PubChem CID 174832794) has the molecular formula C8H19AlO2
and a molecular weight of 174.22 g/mol. Its IUPAC name is alumane;hexyl acetate.
Molecular Properties
| Compound Name | alumane;hexyl acetate |
| PubChem CID | 174832794 |
| Molecular Formula | C8H19AlO2 |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | alumane;hexyl acetate |
| SMILES | CCCCCCOC(C)=O.[AlH3] |
| InChI | InChI=1S/C8H16O2.Al.3H/c1-3-4-5-6-7-10-8(2)9;;;;/h3-7H2,1-2H3;;;; |
| InChIKey | YAJVSUOGGUZKAH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze alumane;hexyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;hexyl acetate?
The IUPAC name of alumane;hexyl acetate (CID 174832794) is alumane;hexyl acetate.
What is the SMILES notation for alumane;hexyl acetate?
The canonical SMILES for alumane;hexyl acetate is CCCCCCOC(C)=O.[AlH3].
What is the InChIKey of alumane;hexyl acetate?
The InChIKey is YAJVSUOGGUZKAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.Al.3H/c1-3-4-5-6-7-10-8(2)9;;;;/h3-7H2,1-2H3;;;;.
What are the key properties of alumane;hexyl acetate?
alumane;hexyl acetate has a molecular weight of 174.22 g/mol, XLogP of 0.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;hexyl acetate is sourced from PubChem (CID 174832794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).