About decyl acetate;ethyl acetate
decyl acetate;ethyl acetate (PubChem CID 158679657) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is decyl acetate;ethyl acetate.
Molecular Properties
| Compound Name | decyl acetate;ethyl acetate |
| PubChem CID | 158679657 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | decyl acetate;ethyl acetate |
| SMILES | CCCCCCCCCCOC(C)=O.CCOC(C)=O |
| InChI | InChI=1S/C12H24O2.C4H8O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13;1-3-6-4(2)5/h3-11H2,1-2H3;3H2,1-2H3 |
| InChIKey | IEYNGVCLGSWVQO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl acetate;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl acetate;ethyl acetate?
The IUPAC name of decyl acetate;ethyl acetate (CID 158679657) is decyl acetate;ethyl acetate.
What is the SMILES notation for decyl acetate;ethyl acetate?
The canonical SMILES for decyl acetate;ethyl acetate is CCCCCCCCCCOC(C)=O.CCOC(C)=O.
What is the InChIKey of decyl acetate;ethyl acetate?
The InChIKey is IEYNGVCLGSWVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C4H8O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13;1-3-6-4(2)5/h3-11H2,1-2H3;3H2,1-2H3.
What are the key properties of decyl acetate;ethyl acetate?
decyl acetate;ethyl acetate has a molecular weight of 288.43 g/mol, XLogP of 4.26, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decyl acetate;ethyl acetate is sourced from PubChem (CID 158679657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).