C30H40N4O8 — CID 174331907
(Z)-but-2-enedioic acid;bis(2-piperazin-1-ylethyl benzoate) (PubChem CID 174331907) has the molecular formula C30H40N4O8 and a molecular weight of 584.67 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(2-piperazin-1-ylethyl benzoate).
| Compound Name | (Z)-but-2-enedioic acid;bis(2-piperazin-1-ylethyl benzoate) |
|---|---|
| PubChem CID | 174331907 |
| Molecular Formula | C30H40N4O8 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(2-piperazin-1-ylethyl benzoate) |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(OCCN1CCNCC1)c1ccccc1.O=C(OCCN1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/2C13H18N2O2.C4H4O4/c2*16-13(12-4-2-1-3-5-12)17-11-10-15-8-6-14-7-9-15;5-3(6)1-2-4(7)8/h2*1-5,14H,6-11H2;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | LNPPEVRUJKGHDQ-KSBRXOFISA-N |
| XLogP | 1.21 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|